20895-45-8 Usage
Uses
Used in Chemical Reactions and Organic Synthesis:
3(2H)-Benzofuranone, 4,7-dimethylis used as a key intermediate in chemical reactions and organic synthesis processes. Its unique structure allows it to participate in a variety of reactions, making it a valuable component in the synthesis of more complex organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3(2H)-Benzofuranone, 4,7-dimethylis used as a building block for the development of new drugs. Its unique chemical properties may contribute to the creation of novel therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Fragrance Industry:
3(2H)-Benzofuranone, 4,7-dimethylis also used in the fragrance industry as a component in the creation of unique and complex scents. Its distinct chemical structure may impart specific olfactory characteristics, making it a valuable addition to the perfumer's palette.
Check Digit Verification of cas no
The CAS Registry Mumber 20895-45-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,8,9 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 20895-45:
(7*2)+(6*0)+(5*8)+(4*9)+(3*5)+(2*4)+(1*5)=118
118 % 10 = 8
So 20895-45-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O2/c1-6-3-4-7(2)10-9(6)8(11)5-12-10/h3-4H,5H2,1-2H3
