209262-62-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-N,N-dimethyl-4-pyridinecarboxamide is used as an intermediate in the synthesis of pharmaceuticals for its ability to introduce the 2-bromo-4-pyridinecarboxamide group into organic molecules, which is crucial for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Bromo-N,N-dimethyl-4-pyridinecarboxamide is employed as an intermediate in the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Organic Synthesis:
2-Bromo-N,N-dimethyl-4-pyridinecarboxamide is used as a reagent in various chemical reactions due to its ability to introduce the 2-bromo-4-pyridinecarboxamide group into organic molecules, facilitating the synthesis of complex organic compounds.
Used in Drug Development:
2-Bromo-N,N-dimethyl-4-pyridinecarboxamide is utilized in the development of potential drug candidates due to its antineoplastic and antiviral properties, making it a promising compound for the creation of new therapeutic agents to combat cancer and viral infections.
Check Digit Verification of cas no
The CAS Registry Mumber 209262-62-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,9,2,6 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 209262-62:
(8*2)+(7*0)+(6*9)+(5*2)+(4*6)+(3*2)+(2*6)+(1*2)=124
124 % 10 = 4
So 209262-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2O/c1-11(2)8(12)6-3-4-10-7(9)5-6/h3-5H,1-2H3
