209336-50-5 Usage
Molecular structure
1-ethyl-1,2,3,4-tetrahydroquinoline-6-methanol has a complex molecular structure that includes an ethyl group, a tetrahydroquinoline ring, and a methanol group.
Usage as a precursor
This chemical compound is commonly used as a precursor in the synthesis of various pharmaceuticals and organic compounds.
Pharmacological properties
1-ethyl-1,2,3,4-tetrahydroquinoline-6-methanol may possess certain pharmacological properties, making it a potential candidate for drug development.
Building block in production
It can be utilized as a building block in the production of specialty chemicals and agrochemicals.
Versatile chemical
1-ethyl-1,2,3,4-tetrahydroquinoline-6-methanol is a versatile chemical with diverse applications in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 209336-50-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,9,3,3 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 209336-50:
(8*2)+(7*0)+(6*9)+(5*3)+(4*3)+(3*6)+(2*5)+(1*0)=125
125 % 10 = 5
So 209336-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO/c1-2-13-7-3-4-11-8-10(9-14)5-6-12(11)13/h5-6,8,14H,2-4,7,9H2,1H3
