209347-66-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Development:
3-(3,7-Dimethyloctyloxy)benzeneboronic acid is utilized as a key intermediate in the synthesis of new pharmaceuticals and agrochemicals. Its unique structure and lipophilic nature facilitate the development of novel compounds with improved biological activity and selectivity.
Used in Organic Synthesis:
In the field of organic synthesis, 3-(3,7-Dimethyloctyloxy)benzeneboronic acid serves as a reagent for the Suzuki coupling reaction. This reaction is a powerful method for forming carbon-carbon bonds, allowing the creation of complex organic molecules with potential applications in various industries.
Used in Materials Science:
3-(3,7-Dimethyloctyloxy)benzeneboronic acid is employed in materials science for the development of new materials with specific properties. Its boronic acid functionality and lipophilic nature can contribute to the design of innovative materials with applications in areas such as electronics, coatings, and adhesives.
Used in Catalysis:
In the realm of catalysis, 3-(3,7-Dimethyloctyloxy)benzeneboronic acid has potential applications as a catalyst or a catalyst precursor. Its unique chemical properties can be harnessed to improve the efficiency and selectivity of various chemical reactions, contributing to advancements in chemical processes and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 209347-66-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,9,3,4 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 209347-66:
(8*2)+(7*0)+(6*9)+(5*3)+(4*4)+(3*7)+(2*6)+(1*6)=140
140 % 10 = 0
So 209347-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H27BO3/c1-13(2)6-4-7-14(3)10-11-20-16-9-5-8-15(12-16)17(18)19/h5,8-9,12-14,18-19H,4,6-7,10-11H2,1-3H3
209347-66-0Relevant academic research and scientific papers
Polymerizable biaryls, method for the production and use thereof
-
, (2008/06/13)
A process for preparing polymerizable biaryl derivatives comprises reacting an aromatic comprising a 6-membered ring which bears ester or benzylic OH groups in the 1,4 position with a second aromatic in a palladium-catalyzed cross-coupling reaction to give a biaryl and converting the ester or benzylic OH groups into polymerizable groups in one or more steps. The biaryls obtained are suitable for preparing polymers which are used as electroluminescence materials.
