209673-76-7 Usage
Uses
Used in Organic Synthesis:
3,4-Bis(2-methylpropyloxy)benzeneboronic acid is used as a building block for the synthesis of various organic molecules, including pharmaceuticals, agrochemicals, and materials. Its unique structure and boronic acid functional group enable it to participate in versatile chemical reactions, making it a valuable tool for researchers and chemists.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
In the field of organic chemistry, 3,4-Bis(2-methylpropyloxy)benzeneboronic acid is used as an important intermediate in Suzuki-Miyaura cross-coupling reactions. This widely used method allows for the formation of carbon-carbon bonds in organic molecules, facilitating the synthesis of complex organic compounds.
Used in Pharmaceutical Industry:
3,4-Bis(2-methylpropyloxy)benzeneboronic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its ability to participate in diverse chemical reactions makes it a valuable component in the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 3,4-Bis(2-methylpropyloxy)benzeneboronic acid is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its versatility in chemical reactions contributes to the development of effective and targeted agrochemical products.
Used in Materials Science:
3,4-Bis(2-methylpropyloxy)benzeneboronic acid is also used in the field of materials science for the synthesis of various materials with specific properties. Its involvement in chemical reactions allows for the creation of materials with tailored characteristics for different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 209673-76-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,9,6,7 and 3 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 209673-76:
(8*2)+(7*0)+(6*9)+(5*6)+(4*7)+(3*3)+(2*7)+(1*6)=157
157 % 10 = 7
So 209673-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H23BO4/c1-10(2)8-18-13-6-5-12(15(16)17)7-14(13)19-9-11(3)4/h5-7,10-11,16-17H,8-9H2,1-4H3
