209733-17-5 Usage
Description
5-(1-piperazinyl)-isoquinoline HCl is a chemical compound characterized by an isoquinoline core with a piperazine group attached at the 5-position. The hydrochloride salt form of this compound, denoted by the HCl, suggests its potential for pharmaceutical applications due to its structural properties and possible pharmacological effects. It is a promising candidate for drug development and research, particularly in the field of medicinal chemistry, where its interactions with biological systems can be explored.
Uses
Used in Pharmaceutical Applications:
5-(1-piperazinyl)-isoquinoline HCl is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure allows it to be studied for interactions with biological systems, which may lead to the development of new drugs with specific pharmacological actions.
Used in Drug Development Research:
In the field of drug development, 5-(1-piperazinyl)-isoquinoline HCl is used as a research tool to investigate its potential as a lead compound. Its structural properties and pharmacological effects can be further explored to understand its mechanism of action and optimize its therapeutic potential.
Used in Medicinal Chemistry:
5-(1-piperazinyl)-isoquinoline HCl is utilized in medicinal chemistry as a target for investigation. Its unique structure and properties make it an interesting subject for studying its interactions with biological systems, which can contribute to the discovery of new drugs and therapeutic agents.
Used in Drug Discovery:
In the process of drug discovery, 5-(1-piperazinyl)-isoquinoline HCl is used as a starting point for the development of new pharmaceuticals. Its potential pharmacological effects and interactions with biological systems can be harnessed to create novel drugs with specific therapeutic applications.
Used in Chemical Synthesis:
5-(1-piperazinyl)-isoquinoline HCl may also be used in chemical synthesis processes, where its unique structure can be modified or combined with other compounds to create new chemical entities with potential pharmaceutical applications. This can lead to the development of a diverse range of drugs with different mechanisms of action and therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 209733-17-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,9,7,3 and 3 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 209733-17:
(8*2)+(7*0)+(6*9)+(5*7)+(4*3)+(3*3)+(2*1)+(1*7)=135
135 % 10 = 5
So 209733-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N3.ClH/c1-2-11-10-15-5-4-12(11)13(3-1)16-8-6-14-7-9-16;/h1-5,10,14H,6-9H2;1H
