21059-46-1 Usage
General Description
Calcium L-aspartate is a compound that consists of calcium with the amino acid L-aspartate. It is commonly used as a dietary supplement due to its role in promoting bone health and muscle function. The body absorbs and utilizes calcium more effectively when it is bound to L-aspartate, making it a popular choice for individuals seeking to increase their calcium intake. Additionally, calcium L-aspartate has been studied for its potential to improve cardiovascular health and reduce the risk of osteoporosis. It is generally well-tolerated and considered safe when taken in recommended doses, but individuals with kidney disease or hypercalcemia should consult their healthcare provider before using calcium L-aspartate supplements.
Check Digit Verification of cas no
The CAS Registry Mumber 21059-46-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,0,5 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21059-46:
(7*2)+(6*1)+(5*0)+(4*5)+(3*9)+(2*4)+(1*6)=81
81 % 10 = 1
So 21059-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H7NO4.Ca/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+2/p-2/t2-;/m0./s1
