211115-05-8 Usage
Uses
Used in Organic Synthesis:
4-Methoxyphenethylmagnesium chloride is used as a reagent in organic synthesis for the introduction of the 4-methoxyphenethyl group into organic molecules. It serves as a source of this group, enabling the formation of carbon-carbon bonds in various chemical reactions.
Used in Grignard Reactions:
In the field of organic chemistry, 4-Methoxyphenethylmagnesium chloride is used as a Grignard reagent for the synthesis of complex organic compounds. It is particularly useful for the introduction of the 4-methoxyphenethyl group into target molecules, facilitating the construction of molecular frameworks and the synthesis of diverse organic compounds.
Used in Pharmaceutical Industry:
4-Methoxyphenethylmagnesium chloride is used as a synthetic intermediate in the pharmaceutical industry for the production of various drugs and medicinal compounds. Its ability to form carbon-carbon bonds and introduce the 4-methoxyphenethyl group makes it a valuable tool in the synthesis of bioactive molecules with potential therapeutic applications.
Used in Material Science:
In material science, 4-Methoxyphenethylmagnesium chloride is used as a precursor in the synthesis of advanced materials, such as polymers, coatings, and composites. Its reactivity in forming carbon-carbon bonds allows for the creation of novel materials with unique properties and applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 211115-05-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,1,1,1 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 211115-05:
(8*2)+(7*1)+(6*1)+(5*1)+(4*1)+(3*5)+(2*0)+(1*5)=58
58 % 10 = 8
So 211115-05-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H11O.ClH.Mg/c1-3-8-4-6-9(10-2)7-5-8;;/h4-7H,1,3H2,2H3;1H;/q;;+1/p-1/rC9H11ClMgO/c1-12-9-4-2-8(3-5-9)6-7-11-10/h2-5H,6-7H2,1H3
