21141-03-7 Usage
Uses
Used in Scientific Research:
3-Amino-4-Pyridazinecarboxylic Acid is used as a chemical intermediate for the synthesis of various compounds in the field of organic chemistry. Its unique structure, featuring both a pyridazine ring and a carboxylic acid group, makes it a valuable building block for the development of new molecules with potential applications in various industries.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-Amino-4-Pyridazinecarboxylic Acid is used as a starting material for the synthesis of drug candidates. Its structural features allow for the creation of novel compounds with potential therapeutic properties, making it an important component in the search for new medications.
Used in Chemical Synthesis:
3-Amino-4-Pyridazinecarboxylic Acid is employed as a reagent in the synthesis of a wide range of chemical products. Its versatility in reacting with other compounds enables the production of various derivatives, which can be used in different applications, such as dyes, pigments, and other specialty chemicals.
Used in Material Science:
In the field of material science, 3-Amino-4-Pyridazinecarboxylic Acid is utilized in the development of new materials with unique properties. Its ability to form complexes with other molecules can lead to the creation of advanced materials with potential applications in electronics, sensors, and other high-tech industries.
Check Digit Verification of cas no
The CAS Registry Mumber 21141-03-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,4 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 21141-03:
(7*2)+(6*1)+(5*1)+(4*4)+(3*1)+(2*0)+(1*3)=47
47 % 10 = 7
So 21141-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-3(5(9)10)1-2-7-8-4/h1-2H,(H2,6,8)(H,9,10)
21141-03-7Relevant academic research and scientific papers
Pyrimidopyridazines. 6. Pyrimidopyridazines and 1,2,4-Triazines from Reactions between 6-Hydrazinopyrimidin-4(3H)-ones and Vicinal Dicarbonyl Reagents
Styles, Virgil L.,Morrison, Robert W.
, p. 346 - 350 (2007/10/02)
Reactions between 6-hydrazinopyrimidin-4(3H)-ones and selected vicinal dicarbonyl reagents have produced novel hydrazonopyrimidines, pyrimidopyridazines, and 1,2,4-triazin-5(2H)-ones.Criteria for the successful cyclizations, unexpected physical/chemical p
