21168-40-1 Usage
Uses
Used in Pharmaceutical Research:
2-(quinolin-3-yl)acetic acid is used as a research compound for its potential therapeutic properties, such as anti-inflammatory, antimicrobial, and antitumor activities. Its diverse pharmacological effects make it a valuable candidate for the development of new drugs and pharmaceuticals.
Used in Cancer Treatment:
In the field of oncology, 2-(quinolin-3-yl)acetic acid is used as a potential antitumor agent. It has been studied for its ability to target and inhibit the growth of cancer cells, making it a promising candidate for cancer therapy.
Used in Alzheimer's Disease Research:
2-(quinolin-3-yl)acetic acid is also being investigated as a potential treatment for Alzheimer's disease. Its potential neuroprotective properties and ability to modulate relevant signaling pathways make it a candidate for further research in this area.
Used in Organic Synthesis:
As a building block in organic synthesis, 2-(quinolin-3-yl)acetic acid is used for the synthesis of complex organic molecules. Its versatile chemical structure allows it to be incorporated into various compounds, contributing to the development of new materials and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 21168-40-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,6 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 21168-40:
(7*2)+(6*1)+(5*1)+(4*6)+(3*8)+(2*4)+(1*0)=81
81 % 10 = 1
So 21168-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2/c13-11(14)6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H,6H2,(H,13,14)
21168-40-1Relevant academic research and scientific papers
Amido macrolides
-
Page/Page column 49, (2010/01/31)
Various macrolide compounds such as those having the following formulas are provided where the variables have the values provided herein.
