211814-16-3 Usage
Uses
Due to the limited information available on N-Cyclopropyl-N-tetrahydro-2H-pyran-4-ylamine, its specific applications are not well-defined. However, given its classification as an amine, it is possible that it could be used in various industries and applications, similar to other amines. Some potential uses might include:
Used in Chemical Synthesis:
N-Cyclopropyl-N-tetrahydro-2H-pyran-4-ylamine could be used as a building block or intermediate in the synthesis of more complex organic compounds, given its unique molecular structure.
Used in Pharmaceutical Industry:
As an amine, N-Cyclopropyl-N-tetrahydro-2H-pyran-4-ylamine might have potential applications in the development of new drugs or pharmaceutical compounds, where its basic nitrogen atom could be involved in forming crucial interactions with biological targets.
Used in Material Science:
N-CYCLOPROPYL-N-TETRAHYDRO-2H-PYRAN-4-YLAMINE's multi-ring structure could potentially be exploited in the development of new materials with specific properties, such as in polymers or other advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 211814-16-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,1,8,1 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 211814-16:
(8*2)+(7*1)+(6*1)+(5*8)+(4*1)+(3*4)+(2*1)+(1*6)=93
93 % 10 = 3
So 211814-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO/c1-2-7(1)9-8-3-5-10-6-4-8/h7-9H,1-6H2
