2122-36-3 Usage
Uses
Used in Pharmaceutical Industry:
[5S,4E,(-)]-4-Ethylidene-1,3,4,5,6,7-hexahydro-6-methylene-2α,5-ethano-2H-azocino[4,3-b]indole is used as a potential pharmaceutical agent for its unique chemical and biological properties. Its specific configuration may allow it to interact with biological targets in ways that could lead to the development of new drugs for treating various diseases.
Used in Agrochemical Industry:
In the agrochemical industry, [5S,4E,(-)]-4-Ethylidene-1,3,4,5,6,7-hexahydro-6-methylene-2α,5-ethano-2H-azocino[4,3-b]indole is used as a potential active ingredient in pesticides or herbicides. Its unique structure may provide novel modes of action against pests or weeds, offering new solutions for agricultural challenges.
Used in Materials Science:
[5S,4E,(-)]-4-Ethylidene-1,3,4,5,6,7-hexahydro-6-methylene-2α,5-ethano-2H-azocino[4,3-b]indole is utilized in materials science for its potential to contribute to the development of new materials with specific properties. Its unique chemical structure could be harnessed to create materials with applications in various industries, such as electronics, coatings, or advanced composites.
Check Digit Verification of cas no
The CAS Registry Mumber 2122-36-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,2 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2122-36:
(6*2)+(5*1)+(4*2)+(3*2)+(2*3)+(1*6)=43
43 % 10 = 3
So 2122-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2/c1-3-13-10-20-9-8-14(13)12(2)18-16(11-20)15-6-4-5-7-17(15)19-18/h3-7,14,19H,2,8-11H2,1H3/b13-3-/t14-/m1/s1
