21224-16-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Benzothiazolamine,6-ethyl-(9CI) is used as a pharmaceutical intermediate for the development of various therapeutic agents. Its unique chemical structure allows it to be a key component in the synthesis of drugs with potential applications in treating a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Benzothiazolamine,6-ethyl-(9CI) is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties make it suitable for the development of compounds that can effectively control pests and weeds in agricultural settings.
Used in Dye Industry:
2-Benzothiazolamine,6-ethyl-(9CI) is employed as a dye intermediate in the dye industry. Its aromatic structure and functional groups contribute to the creation of dyes with specific color properties and stability, making it valuable for various applications in textiles, plastics, and other materials.
Used in Chemical Synthesis:
2-Benzothiazolamine,6-ethyl-(9CI) serves as an intermediate in the synthesis of other chemical compounds. Its unique structure and reactivity make it a versatile building block for the development of new organic compounds with potential applications in various industries, including pharmaceuticals, materials science, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 21224-16-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,2 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21224-16:
(7*2)+(6*1)+(5*2)+(4*2)+(3*4)+(2*1)+(1*6)=58
58 % 10 = 8
So 21224-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2S/c1-2-6-3-4-7-8(5-6)12-9(10)11-7/h3-5H,2H2,1H3,(H2,10,11)
