212307-87-4 Usage
Uses
Used in Organic Synthesis:
Benzene, 1-bromo-3-ethoxy-5-fluoro(9CI) is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique structure with a bromine atom, an ethoxy group, and a fluorine atom allows for versatile reactions and the formation of a wide range of products.
Used in Research Applications:
Benzene, 1-bromo-3-ethoxy-5-fluoro(9CI) is also utilized in research settings to study chemical reactions and mechanisms. Its distinct properties make it a valuable tool for understanding the behavior of different functional groups and their interactions in chemical processes.
Used in Pharmaceutical Industry:
Benzene, 1-bromo-3-ethoxy-5-fluoro(9CI) can be used as an intermediate in the synthesis of pharmaceutical compounds. Its unique structure may contribute to the development of new drugs with specific therapeutic properties.
Safety Precautions:
Due to its flammable and corrosive nature, Benzene, 1-bromo-3-ethoxy-5-fluoro(9CI) should be stored and used in a well-ventilated area. Proper personal protective equipment, such as gloves, goggles, and a lab coat, should be worn when handling this chemical to minimize the risk of exposure and potential health hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 212307-87-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,2,3,0 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 212307-87:
(8*2)+(7*1)+(6*2)+(5*3)+(4*0)+(3*7)+(2*8)+(1*7)=94
94 % 10 = 4
So 212307-87-4 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8BrFO/c1-2-11-8-4-6(9)3-7(10)5-8/h3-5H,2H2,1H3
