2125-74-8 Usage
General Description
1-Acetyl-4-amino-2,5-dihydro-1H-pyrrole-3-carbonitrile is a chemical compound with the molecular formula C9H10N4O. It is a pyrrole derivative with an acetyl group and an amino group attached to the pyrrole ring, as well as a carbonitrile functional group. 1-ACETYL-4-AMINO-2,5-DIHYDRO-1H-PYRROLE-3-CARBONITRILE has potential applications in the pharmaceutical industry, particularly in the development of new drugs and treatments. Its chemical structure and properties make it a suitable candidate for further research and development to explore its potential medicinal uses, such as in the synthesis of new therapeutic agents or as a building block for more complex compounds. However, further studies and testing would be necessary to fully understand its potential effects and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2125-74-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,2 and 5 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2125-74:
(6*2)+(5*1)+(4*2)+(3*5)+(2*7)+(1*4)=58
58 % 10 = 8
So 2125-74-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O/c1-5(11)10-3-6(2-8)7(9)4-10/h3-4,9H2,1H3