21256-15-5 Usage
General Description
2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic Acid is a chemical compound with thiazole as the crucial ring structure in its molecular configuration. Thiazole is a heterocyclic compound, which signifies that it contains atoms of at least two different elements as part of its ring structure. Its distinguishing features are that its rings include both sulfur and nitrogen atoms, which lend it unique chemical properties. This chemical, 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic Acid, is categorized under diphenyl thiazoles, which can potentially interact with various bioactive molecules, giving it importance in medicinal and pharmaceutical spaces. The acetic acid components also suggest its potential interactions with biological systems. However, further studies are required to better understand its characteristics, functionalities, and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 21256-15-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,5 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 21256-15:
(7*2)+(6*1)+(5*2)+(4*5)+(3*6)+(2*1)+(1*5)=75
75 % 10 = 5
So 21256-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H13NO2S/c19-15(20)11-14-16(12-7-3-1-4-8-12)18-17(21-14)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,20)
