2126-70-7 Usage
Uses
Used in Chemical Synthesis:
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is used as a synthetic building block for creating a variety of organic compounds due to its reactive bromoacrylic acid group and aromatic anisoyl group. The presence of the bromine atom allows for further functionalization and modification in chemical reactions.
Used in Pharmaceutical Industry:
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is used as an intermediate in the synthesis of pharmaceutical compounds, leveraging its unique structural features to develop new drugs with potential therapeutic applications.
Used in Material Science:
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is used as a component in the development of novel materials, such as plastics and polymers, where its aromatic and bromine-containing properties can contribute to enhanced material characteristics.
Used in Dye and Pigment Industry:
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is used as a starting material for the production of dyes and pigments, taking advantage of its aromatic properties to create vibrant and stable colorants for various applications.
Used in Analytical Chemistry:
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is used as a reagent or reference compound in analytical chemistry for the detection, identification, and quantification of specific substances, benefiting from its distinct chemical and physical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 2126-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,2 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2126-70:
(6*2)+(5*1)+(4*2)+(3*6)+(2*7)+(1*0)=57
57 % 10 = 7
So 2126-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrO4.Na/c1-16-8-4-2-7(3-5-8)11(15)9(12)6-10(13)14;/h2-6H,1H3,(H,13,14);/q;+1/p-1/b9-6-;
