2126-70-7 Usage
General Description
(Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt is a chemical compound that consists of an anisoyl group, a bromoacrylic acid group, and a sodium salt. It is a derivative of acrylic acid, which is commonly used in the production of plastics and other materials. The presence of the anisoyl group in the compound gives it aromatic properties, while the bromoacrylic acid group adds a bromine atom to the molecule, which can be useful in certain chemical reactions. The sodium salt form of the compound indicates that it is a derivative of acrylic acid that has been neutralized with sodium, making it more stable and soluble in water. (Z)-3-(p-Anisoyl)-3-bromoacrylic acid sodium salt may have potential applications in various chemical processes and industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2126-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,2 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2126-70:
(6*2)+(5*1)+(4*2)+(3*6)+(2*7)+(1*0)=57
57 % 10 = 7
So 2126-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrO4.Na/c1-16-8-4-2-7(3-5-8)11(15)9(12)6-10(13)14;/h2-6H,1H3,(H,13,14);/q;+1/p-1/b9-6-;
