2126-91-2 Usage
General Description
DL-Kynurenine sulfate salt is a chemical compound derived from the amino acid tryptophan and plays a crucial role in the kynurenine pathway, which is involved in the metabolism of tryptophan. It is a potent antioxidant and has been found to have neuroprotective properties, making it a potential therapeutic agent for various neurological disorders. Additionally, DL-Kynurenine sulfate salt has been studied for its anti-inflammatory and immunomodulatory effects, with potential applications in the treatment of inflammatory and autoimmune diseases. Moreover, it has been investigated for its role in regulating the immune response and promoting tolerance in the setting of organ transplantation. Overall, DL-Kynurenine sulfate salt is a compound of interest for its diverse biological activities and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2126-91-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,2 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2126-91:
(6*2)+(5*1)+(4*2)+(3*6)+(2*9)+(1*1)=62
62 % 10 = 2
So 2126-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1
