21270-14-4 Usage
Uses
Used in Pharmaceutical Industry:
[α-(Bromomethyl)-p-cyclohexylbenzyl]hexyl ether is used as a key intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs and medications.
Used in Agrochemical Industry:
In the agrochemical sector, [α-(Bromomethyl)-p-cyclohexylbenzyl]hexyl ether is utilized as an intermediate in the production of different agrochemicals. Its chemical properties contribute to the creation of effective and targeted products for agricultural applications.
Used in Specialty Chemicals:
[α-(Bromomethyl)-p-cyclohexylbenzyl]hexyl ether is also employed in the synthesis of specialty chemicals, where its complex structure and reactivity are harnessed to create unique and specific compounds for various applications.
Used as a Reagent in Organic Synthesis:
This chemical serves as a reagent in organic synthesis, where it is used to build complex molecular structures. Its versatility and unique properties make it an essential tool in the development of intricate organic compounds.
Safety Precaution:
It is crucial to handle [α-(Bromomethyl)-p-cyclohexylbenzyl]hexyl ether with care due to its potential hazardous properties and reactivity. Proper safety measures and precautions should be taken during its use to ensure the safety of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 21270-14-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,7 and 0 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 21270-14:
(7*2)+(6*1)+(5*2)+(4*7)+(3*0)+(2*1)+(1*4)=64
64 % 10 = 4
So 21270-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H31BrO/c1-2-3-4-8-15-22-20(16-21)19-13-11-18(12-14-19)17-9-6-5-7-10-17/h11-14,17,20H,2-10,15-16H2,1H3
