21271-15-8 Usage
Uses
Used in Pharmaceutical Industry:
2,3,5,6,7,8-hexafluoroquinoxaline is used as a key building block for the synthesis of various pharmaceuticals due to its ability to form stable bonds with other molecules, contributing to the development of new drugs with improved properties.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,5,6,7,8-hexafluoroquinoxaline serves as a crucial component in the creation of effective and stable agrochemicals, enhancing their performance and durability in agricultural applications.
Used in Materials Science:
2,3,5,6,7,8-hexafluoroquinoxaline is utilized as a fundamental building block in materials science for the development of innovative materials with unique properties, such as high thermal and chemical stability, broadening the horizons of material applications across various industries.
Used in Research Applications:
Due to its low toxicity and unique chemical properties, 2,3,5,6,7,8-hexafluoroquinoxaline is employed in various research applications, facilitating the exploration of new chemical reactions and the discovery of novel compounds with potential applications in diverse fields.
Check Digit Verification of cas no
The CAS Registry Mumber 21271-15-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,7 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 21271-15:
(7*2)+(6*1)+(5*2)+(4*7)+(3*1)+(2*1)+(1*5)=68
68 % 10 = 8
So 21271-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C8F6N2/c9-1-2(10)4(12)6-5(3(1)11)15-7(13)8(14)16-6
