21282-08-6 Usage
Uses
Used in Pharmaceutical Industry:
PYR-ALA-OH is used as a key intermediate in the synthesis of glutamyl peptides for the development of novel therapeutic agents. Its ability to form stable peptide bonds with carbobenzyloxy-L-pyroglutamic acid allows for the creation of bioactive compounds with potential applications in treating various diseases and medical conditions.
Used in Cosmetic Industry:
PYR-ALA-OH is used as an active ingredient in cosmetic formulations for its potential skin-protecting and anti-aging properties. Its ability to form stable peptide bonds with other compounds can contribute to the development of innovative skincare products that promote skin health and rejuvenation.
Used in Research and Development:
PYR-ALA-OH is utilized as a valuable research tool in the development of new synthetic methods and techniques for the production of glutamyl peptides and other bioactive compounds. Its unique chemical properties make it an essential component in the advancement of scientific knowledge and the discovery of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 21282-08-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,8 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 21282-08:
(7*2)+(6*1)+(5*2)+(4*8)+(3*2)+(2*0)+(1*8)=76
76 % 10 = 6
So 21282-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O4/c1-4(8(13)14)9-7(12)5-2-3-6(11)10-5/h4-5H,2-3H2,1H3,(H,9,12)(H,10,11)(H,13,14)/t4-,5-/m0/s1
