21323-87-5 Usage
Uses
Used in Pharmaceutical Research:
N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE is used as a research compound for its potential biological activities, such as anticancer, antiviral, and anti-inflammatory effects. Its ability to interact with various cellular pathways and protein targets makes it a valuable tool in the development of new therapeutic agents.
Used in Drug Development:
N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE is used as a candidate for drug development due to its potential therapeutic effects in treating various diseases and conditions. Its versatility in interacting with different cellular pathways and protein targets allows for the exploration of its potential in addressing a wide range of medical needs.
Used in Anticancer Applications:
In the field of oncology, N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE is used as a potential anticancer agent. Its ability to target and interact with specific cellular pathways and protein targets involved in cancer progression makes it a promising candidate for the development of new cancer therapies.
Used in Antiviral Applications:
N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE is used as a potential antiviral agent, with its ability to target and inhibit viral replication and infection processes. This makes it a valuable compound in the development of new antiviral drugs to combat various viral diseases.
Used in Anti-inflammatory Applications:
In the field of inflammation and immune response, N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE is used as a potential anti-inflammatory agent. Its ability to modulate inflammatory pathways and protein targets involved in the inflammatory response makes it a promising candidate for the development of new treatments for inflammatory diseases.
As research and studies continue, the potential applications of N-(1,6-DIHYDRO-6-OXOPURIN-2-YL)-BENZAMIDE may expand, further solidifying its role in the pharmaceutical industry and medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 21323-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,2 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21323-87:
(7*2)+(6*1)+(5*3)+(4*2)+(3*3)+(2*8)+(1*7)=75
75 % 10 = 5
So 21323-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H9N5O2/c18-10(7-4-2-1-3-5-7)16-12-15-9-8(11(19)17-12)13-6-14-9/h1-6,8H,(H2,13,14,15,16,17,18,19)
