21344-26-3 Usage
Uses
Used in Pharmaceutical Development:
Thieno[2,3-b]pyridin-5-ol is used as a building block for the synthesis of various pharmaceutical compounds due to its unique molecular structure and potential bioactivity. Its ability to inhibit certain enzymes makes it a promising candidate for the development of new drugs targeting specific biological pathways.
Used in Chemical Research:
In the field of chemical research, Thieno[2,3-b]pyridin-5-ol is utilized for its potential to contribute to the understanding of heterocyclic chemistry and its applications. Its unique ring structure with sulfur and nitrogen atoms provides a platform for exploring novel chemical reactions and properties.
Used in Drug Discovery:
Thieno[2,3-b]pyridin-5-ol is employed as a starting point in drug discovery processes, where its enzyme-inhibiting properties are leveraged to identify potential therapeutic agents. Thieno[2,3-b]pyridin-5-ol's interaction with biological targets can lead to the development of new treatments for various diseases and conditions.
Used in Material Science:
While not explicitly mentioned in the provided materials, given its unique chemical structure, Thieno[2,3-b]pyridin-5-ol may also have applications in material science, potentially serving as a component in the development of new materials with specific properties, such as conductivity or stability.
Further investigation into the properties and potential uses of Thieno[2,3-b]pyridin-5-ol is ongoing, which may reveal additional applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 21344-26-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,4 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21344-26:
(7*2)+(6*1)+(5*3)+(4*4)+(3*4)+(2*2)+(1*6)=73
73 % 10 = 3
So 21344-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NOS/c9-6-3-5-1-2-10-7(5)8-4-6/h1-4,9H
