21352-22-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-2-methylquinoline is utilized as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly in the anesthetic and anti-malarial drug categories. Its potential as an anesthetic has been studied, and it serves as a precursor for the production of anti-malarial medications, contributing to the advancement of medical treatments.
Used in Dye Industry:
In the dye industry, 3-Amino-2-methylquinoline is employed as an intermediate for the production of various dyes. Its chemical properties make it suitable for creating a range of colors and hues, enhancing the colorfastness and vibrancy of dyes used in textiles, plastics, and other materials.
Used in Optoelectronic Industry:
3-Amino-2-methylquinoline is known for its photoluminescent properties, which make it a valuable component in the development of optoelectronic materials and devices. Its ability to emit light upon exposure to certain wavelengths of light allows it to be used in applications such as light-emitting diodes (LEDs), solar cells, and other optoelectronic technologies, contributing to the advancement of energy-efficient and high-performance devices.
However, it is crucial to handle 3-Amino-2-methylquinoline with care due to its potential toxic effects. It should be used in a controlled laboratory setting to ensure safety and minimize risks associated with its use. Despite these precautions, 3-Amino-2-methylquinoline remains a promising compound with a wide range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 21352-22-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,5 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21352-22:
(7*2)+(6*1)+(5*3)+(4*5)+(3*2)+(2*2)+(1*2)=67
67 % 10 = 7
So 21352-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2/c1-7-9(11)6-8-4-2-3-5-10(8)12-7/h2-6H,11H2,1H3
