21382-25-2 Usage
Uses
Used in Pharmaceutical Industry:
(CIS)-8-METHYLNON-6-ENOIC ACID is used as an intermediate in the synthesis of Dihydro Capsaicin (D448750), which is a Capsaicin (C175680) analog. It acts as a VR1 vaniloid receptor agonist, targeting the vanilloid receptor subtype 1 (VR1) and modulating its activity. This interaction has potential applications in the development of pain relief therapies and other treatments that involve the modulation of VR1 receptors.
Additionally, the compound may be utilized in the synthesis of other Capsaicin analogs, which could have various applications in the pharmaceutical industry, such as the development of novel analgesics, anti-inflammatory agents, or other therapeutic compounds targeting the VR1 receptor or related pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 21382-25-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,8 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 21382-25:
(7*2)+(6*1)+(5*3)+(4*8)+(3*2)+(2*2)+(1*5)=82
82 % 10 = 2
So 21382-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O2/c1-9(2)7-5-3-4-6-8-10(11)12/h5,7,9H,3-4,6,8H2,1-2H3,(H,11,12)/b7-5+
