21394-53-6 Usage
General Description
2-[(1-Adamantylcarbonyl)amino]-4-(methylthio)butanoic acid, also known as AMTB, is a chemical compound with potential applications in the field of neuroscience and drug development. It is a selective and potent agonist of the transient receptor potential cation channel subfamily M member 8 (TRPM8), which plays a crucial role in the sensation of cold temperatures and the regulation of pain processing. AMTB has been used in research to investigate the physiological and pathological functions of TRPM8, as well as its potential as a target for the development of novel pain-relief medications. Additionally, AMTB has been found to inhibit the growth of various cancer cells in vitro, suggesting its potential in cancer therapy. However, further research is needed to fully understand the therapeutic applications and potential side effects of AMTB.
Check Digit Verification of cas no
The CAS Registry Mumber 21394-53-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,9 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 21394-53:
(7*2)+(6*1)+(5*3)+(4*9)+(3*4)+(2*5)+(1*3)=96
96 % 10 = 6
So 21394-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H25NO3S/c1-21-3-2-13(14(18)19)17-15(20)16-7-10-4-11(8-16)6-12(5-10)9-16/h10-13H,2-9H2,1H3,(H,17,20)(H,18,19)/p-1/t10?,11?,12?,13-,16?/m1/s1
