21395-07-3 Usage
Uses
Used in Organic Synthesis:
[α-(Bromomethyl)-p-chlorobenzyl]sec-butyl ether is used as a synthetic intermediate for the creation of various organic compounds. Its unique structure, which includes bromine and chlorine atoms, allows for versatile reactivity and the potential to form a wide range of products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [α-(Bromomethyl)-p-chlorobenzyl]sec-butyl ether is used as a building block for the development of new drugs. The presence of the bromomethyl and p-chlorobenzyl groups can be exploited to create novel molecular structures with potential therapeutic applications.
Used in Chemical Processes:
[α-(Bromomethyl)-p-chlorobenzyl]sec-butyl ether is also utilized as a reagent in various chemical processes. Its structural features enable it to participate in a range of reactions, making it a valuable asset in the synthesis of more complex organic molecules.
Used in Research and Development:
[α-(Bromomethyl)-p-chlorobenzyl]sec-butyl ether serves as a key compound in research and development, particularly in the exploration of new chemical reactions and the synthesis of innovative organic compounds. Its unique properties make it an interesting subject for scientific study and potential commercial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 21395-07-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,3,9 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21395-07:
(7*2)+(6*1)+(5*3)+(4*9)+(3*5)+(2*0)+(1*7)=93
93 % 10 = 3
So 21395-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16BrClO/c1-3-9(2)15-12(8-13)10-4-6-11(14)7-5-10/h4-7,9,12H,3,8H2,1-2H3
