21417-18-5 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-N-CYCLOHEX-1-EN-1-YL-N-ETHYLACETAMIDE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into the development of new medicinal compounds, enhancing their therapeutic properties and effectiveness in treating various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 2-CHLORO-N-CYCLOHEX-1-EN-1-YL-N-ETHYLACETAMIDE serves as a building block in the production of fungicides and insecticides. Its incorporation into these products helps improve their efficacy in controlling pests and diseases, thereby contributing to increased crop yields and food security.
Used in Organic Synthesis:
2-CHLORO-N-CYCLOHEX-1-EN-1-YL-N-ETHYLACETAMIDE is also used as a valuable building block in organic synthesis. Its versatile structure allows it to be modified and combined with other chemical entities, leading to the creation of novel compounds with potential applications in various fields, including materials science, catalysis, and environmental chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 21417-18-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,1 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 21417-18:
(7*2)+(6*1)+(5*4)+(4*1)+(3*7)+(2*1)+(1*8)=75
75 % 10 = 5
So 21417-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H16ClNO/c1-2-12(10(13)8-11)9-6-4-3-5-7-9/h6H,2-5,7-8H2,1H3
