21467-12-9 Usage
Uses
Used in Research Applications:
Z-ALA-ASN-OH is used as a research tool for studying the interactions of amino acids and their derivatives with biological systems and molecules. Its unique structure allows for the investigation of protein synthesis mechanisms and the development of novel peptide synthesis techniques.
Used in Pharmaceutical Applications:
Z-ALA-ASN-OH is used as a pharmaceutical intermediate for the development of new drugs and therapeutic agents. Its modified structure may offer specific binding properties and interactions with target molecules, potentially leading to the discovery of innovative treatments for various diseases and conditions.
Used in Peptide Synthesis:
Z-ALA-ASN-OH is used as a building block in the synthesis of peptides and other bioactive compounds. Its incorporation into peptide sequences can provide unique properties and functions, contributing to the development of novel biopharmaceuticals and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 21467-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,6 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21467-12:
(7*2)+(6*1)+(5*4)+(4*6)+(3*7)+(2*1)+(1*2)=89
89 % 10 = 9
So 21467-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H19N3O6/c1-9(13(20)18-11(14(21)22)7-12(16)19)17-15(23)24-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3,(H2,16,19)(H,17,23)(H,18,20)(H,21,22)
