214848-62-1 Usage
Uses
Used in Pharmaceutical Industry:
3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-7-CARBOXYLIC ACID is used as a pharmaceutical intermediate for the synthesis of various drugs and medications due to its unique benzoxazine structure and carboxylic acid group, which can be utilized in the development of novel therapeutic agents.
Used in Organic Chemistry Research:
3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-7-CARBOXYLIC ACID serves as a key molecule in organic chemistry research, where its heterocyclic structure and functional groups can be explored for the synthesis of complex organic compounds and the investigation of their properties and reactions.
Used in Drug Development:
3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-7-CARBOXYLIC ACID is used as a potential lead compound in drug development, given its intriguing structure and the possibility of exhibiting biological activities that can be harnessed for therapeutic purposes. Further research and exploration in this area can lead to the discovery of new medications and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 214848-62-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,4,8,4 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 214848-62:
(8*2)+(7*1)+(6*4)+(5*8)+(4*4)+(3*8)+(2*6)+(1*2)=141
141 % 10 = 1
So 214848-62-1 is a valid CAS Registry Number.
InChI:InChI=1S/C9H7NO4/c11-8-4-14-7-3-5(9(12)13)1-2-6(7)10-8/h1-3H,4H2,(H,10,11)(H,12,13)
