21486-28-2 Usage
General Description
3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolecarbonitrile is a chemical compound that belongs to the class of isoxazolecarbonitrile compounds. It is known to have potential biological and pharmaceutical applications due to its diverse properties and activities. 3-(2,6-DICHLOROPHENYL)-5-METHYL-4-ISOXAZOLECARBONITRILE has been studied for its antimicrobial, antifungal, and herbicidal activities. Additionally, it has also shown potential as an inhibitor of specific enzymes and as a potential bioactive molecule. Its unique chemical structure and properties make it a valuable candidate for further research and potential applications in various industries including pharmaceuticals, agriculture, and medical research.
Check Digit Verification of cas no
The CAS Registry Mumber 21486-28-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,8 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 21486-28:
(7*2)+(6*1)+(5*4)+(4*8)+(3*6)+(2*2)+(1*8)=102
102 % 10 = 2
So 21486-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H6Cl2N2O/c1-6-7(5-14)11(15-16-6)10-8(12)3-2-4-9(10)13/h2-4H,1H3
21486-28-2Relevant articles and documents
Electrochemical and yeast-catalysed ring-opening of isoxazoles in the synthesis of analogues of the herbicide Grasp
Easton,Heath,Hughes,Lee,Savage,Simpson,Tiekink,Vuckovic,Webster
, p. 1168 - 1174 (2007/10/03)
Isoxazoles substituted with an electron-withdrawing group at the 4-position undergo electrochemical and yeast-catalysed N-O bond cleavage. The electrolysis is much more efficient and, with acyl- and alkoxycarbonyl-substituted isoxazoles, it affords the enolised dicarbonylimine functionality characteristic of the herbicide Grasp. Regioisomeric 4- and 5-substituted isoxazoles are accessible through nitrile oxide cycloaddition chemistry, using halogen as a steric auxiliary to control the regiochemistry of reaction. Crystal data for compounds 11 and 19b are presented.
