21487-27-4 Usage
Check Digit Verification of cas no
The CAS Registry Mumber 21487-27-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,8 and 7 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21487-27:
(7*2)+(6*1)+(5*4)+(4*8)+(3*7)+(2*2)+(1*7)=104
104 % 10 = 4
So 21487-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3S/c1-10-6-2-3-7-11(10)15-13(17)16-12-8-4-5-9-14-12/h2-9H,1H3,(H2,14,15,16,17)
21487-27-4Relevant academic research and scientific papers
Structural and spectral studies of N-(2-pyridyl)-N'-tolylthioureas
Valdes-Martinez, Jesus,Hernandez-Ortega, Simon,West, Douglas X.,Ackerman, Lily J.,Swearingen, John K.,Hermetet, Anne K.
, p. 219 - 226 (2007/10/03)
N-(2-pyridyl)-N'-o-tolylthiourea, monoclinic, P21/c, a = 5,127(1), b = 19.854(2), c = 12.077(2), A, β = 94.96(1)°, V = 1224,7(2) A3, Z = 4, μ = 2.177 mm-1, N-(2-pyridyl)-N'-m-tolylthiourea, triclinic, P - 1, a = 9.811(2),
