215032-19-2 Usage
Uses
Used in Organic Synthesis:
2,3,5,6-Tetramethylpyridine-4-carboxamide is used as a reagent in organic synthesis for the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows it to serve as a key intermediate in the synthesis of complex organic molecules, contributing to the development of new and effective compounds for various applications.
Used in Materials Science:
In the field of materials science, 2,3,5,6-Tetramethylpyridine-4-carboxamide has been studied for its potential applications as a component of photoactive materials and organic electronic devices. Its ability to interact with light and other materials makes it a promising candidate for use in the development of advanced materials with specific properties, such as light-emitting diodes, solar cells, and other optoelectronic devices.
Used in Pharmaceutical Industry:
2,3,5,6-Tetramethylpyridine-4-carboxamide is used as a building block in the synthesis of complex organic molecules for pharmaceutical applications. Its unique structure and reactivity make it a valuable component in the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 2,3,5,6-Tetramethylpyridine-4-carboxamide is utilized as a key intermediate in the synthesis of various agrochemicals, such as pesticides and herbicides. Its role in the development of these compounds helps to improve agricultural productivity and crop protection.
Check Digit Verification of cas no
The CAS Registry Mumber 215032-19-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,5,0,3 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 215032-19:
(8*2)+(7*1)+(6*5)+(5*0)+(4*3)+(3*2)+(2*1)+(1*9)=82
82 % 10 = 2
So 215032-19-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O/c1-5-7(3)12-8(4)6(2)9(5)10(11)13/h1-4H3,(H2,11,13)
215032-19-2Relevant academic research and scientific papers
Hydroxymethylation and carbamoylation of di- and tetramethylpyridines using radical substitution (minisci) reactions
Amrollahi Biyouki, Mohammad A.,Smith, Robin A. J.,Bedford, Jennifer J.,Leader, John P.
, p. 3817 - 3825 (2007/10/03)
Reaction of hydroxymethyl radicals with N-methoxy 2,4- and 2,6- dimethylpyridinium salts gave 2,4,6-substituted hydroxymethylpyridines. Similar reactions with 2,3,5,6-tetramethylpyridine and derivatives failed, however 4-substitution could be achieved using a carbamoyl radical.
