2152-70-7 Usage
Uses
Used in Pharmaceutical Industry:
1,5-bis(5-nitro-2-furyl)penta-1,4-dien-3-one is used as an intermediate in the synthesis of Nitrovin Hydrochloride (N494710), a veterinary anti-infective agent. It plays a vital role in the development of 1,5-bis(5-nitro-2-furyl)penta-1,4-dien-3-one, which is essential for treating various infections in animals.
Used in Chemical Industry:
In the chemical industry, 1,5-bis(5-nitro-2-furyl)penta-1,4-dien-3-one can be utilized as a building block for the synthesis of other complex organic molecules. Its unique structure and functional groups make it a valuable component in the creation of novel compounds with potential applications in various fields, such as materials science, agrochemicals, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 2152-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,5 and 2 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2152-70:
(6*2)+(5*1)+(4*5)+(3*2)+(2*7)+(1*0)=57
57 % 10 = 7
So 2152-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H8N2O7/c16-9(1-3-10-5-7-12(21-10)14(17)18)2-4-11-6-8-13(22-11)15(19)20/h1-8H/b3-1-,4-2+
