215364-83-3 Usage
Description
3-([(Diethylamino)carbonyl]oxy)-4-pyridinecarboxylic acid is a chemical compound belonging to the pyridinecarboxylic acid family, characterized by the molecular formula C15H18N2O4. It features a diethylamino carbonyl group and exhibits a diverse range of applications due to its unique structure and properties.
Uses
Used in Pharmaceutical and Agrochemical Industries:
3-([(Diethylamino)carbonyl]oxy)-4-pyridinecarboxylic acid serves as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides.
Used as a Reagent in Organic Synthesis:
3-([(DIETHYLAMINO)CARBONYL]OXY)-4-PYRIDINECARBOXYLIC ACID is utilized as a reagent in organic synthesis, facilitating the formation of different organic compounds and aiding in various chemical reactions.
Used as a Building Block in Compound Preparation:
3-([(Diethylamino)carbonyl]oxy)-4-pyridinecarboxylic acid acts as a building block in the preparation of a variety of compounds, playing a crucial role in the construction of complex molecular structures.
Used in Therapeutic Research:
3-([(Diethylamino)carbonyl]oxy)-4-pyridinecarboxylic acid has been studied for its potential therapeutic properties, including anti-inflammatory and anti-cancer activities, indicating its promise as a candidate for future medicinal applications.
Check Digit Verification of cas no
The CAS Registry Mumber 215364-83-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,5,3,6 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 215364-83:
(8*2)+(7*1)+(6*5)+(5*3)+(4*6)+(3*4)+(2*8)+(1*3)=123
123 % 10 = 3
So 215364-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O4/c1-3-13(4-2)11(16)17-9-7-12-6-5-8(9)10(14)15/h5-7H,3-4H2,1-2H3,(H,14,15)
