215434-62-1 Usage
Uses
Used in Pharmaceutical Research:
2-[4-(3-Nitro-2-Pyridyl)Piperazino]Ethan-1-ol is used as a chemical intermediate for the synthesis of more complex pharmaceutical compounds, particularly in the development of new drugs. Its structure, which includes a piperazino group, suggests potential applications in the creation of antipsychotic medications and other therapeutic agents.
Used in Chemical Research:
In the field of chemical research, 2-[4-(3-Nitro-2-Pyridyl)Piperazino]Ethan-1-ol is used as a building block for the assembly of more complex organic molecules. Its unique combination of functional groups, such as the nitro and pyridyl groups, allows for a wide range of chemical reactions and modifications, making it a valuable tool for exploring new chemical pathways and syntheses.
Used in Material Science:
2-[4-(3-Nitro-2-Pyridyl)Piperazino]Ethan-1-ol may also find applications in material science, where its properties can be harnessed to develop new materials with specific characteristics. 2-[4-(3-NITRO-2-PYRIDYL)PIPERAZINO]ETHAN-1-OL's potential reactivity and bioactivity could be utilized in the creation of advanced materials for various industries, such as electronics, coatings, or even biomedical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 215434-62-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,5,4,3 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 215434-62:
(8*2)+(7*1)+(6*5)+(5*4)+(4*3)+(3*4)+(2*6)+(1*2)=111
111 % 10 = 1
So 215434-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N4O3/c16-9-8-13-4-6-14(7-5-13)11-10(15(17)18)2-1-3-12-11/h1-3,16H,4-9H2
