2158-70-5 Usage
Property
Different sources of media describe the Property of 2158-70-5 differently. You can refer to the following data:
1. Synthetic compound
2. Classified as a nitrogen mustard
3. Belongs to a class of chemicals known as alkylating agents
4. Used in chemotherapy to inhibit the growth of cancer cells
Content
Different sources of media describe the Content of 2158-70-5 differently. You can refer to the following data:
1. Contains two chloroethyl groups attached to an amino group
2. Contains a cyclohexadiene-1,4-dione structure with a methyl group
3. Forms covalent bonds with DNA
4. Leads to DNA cross-linking and cell death
5. Used in the treatment of lymphoma, leukemia, and multiple myeloma
Check Digit Verification of cas no
The CAS Registry Mumber 2158-70-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,5 and 8 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2158-70:
(6*2)+(5*1)+(4*5)+(3*8)+(2*7)+(1*0)=75
75 % 10 = 5
So 2158-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13Cl2NO2/c1-8-6-11(16)9(7-10(8)15)14(4-2-12)5-3-13/h6-7H,2-5H2,1H3
