215872-46-1 Usage
Uses
Used in Pharmaceutical Industry:
4-Methylisoxazole-3-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its antimicrobial and anti-inflammatory properties. It plays a crucial role in the development of new drugs targeting a wide range of diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Methylisoxazole-3-carboxylic acid is used as a building block for the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Material Science:
4-Methylisoxazole-3-carboxylic acid is utilized in the development of new materials due to its unique chemical properties, which can enhance the performance and functionality of various materials.
Used in Organic Synthesis:
As a versatile chemical compound, 4-Methylisoxazole-3-carboxylic acid is employed in organic synthesis for the preparation of a variety of organic compounds, expanding the scope of chemical research and development.
Used in Disease Treatment Research:
4-Methylisoxazole-3-carboxylic acid is studied for its potential in the treatment of various diseases and disorders, leveraging its unique chemical properties and biological effects to explore new therapeutic avenues.
Check Digit Verification of cas no
The CAS Registry Mumber 215872-46-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,5,8,7 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 215872-46:
(8*2)+(7*1)+(6*5)+(5*8)+(4*7)+(3*2)+(2*4)+(1*6)=141
141 % 10 = 1
So 215872-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO3/c1-3-10-7(9)6-5(2)4-11-8-6/h4H,3H2,1-2H3
