2159-36-6 Usage
Molecular structure
2-(3-methoxybenzoyl)benzoic acid consists of a benzoyl group (a benzene ring with a carbonyl group) and a salicylic acid group (a hydroxybenzoic acid) attached to a benzene ring.
Applications
It is commonly used in the synthesis of organic compounds and has applications in the pharmaceutical and fragrance industries.
Antioxidant and anti-inflammatory properties
The presence of the methoxy and carboxyl groups in the molecule gives it potential antioxidant and anti-inflammatory properties, making it a potential candidate for use in medicinal applications.
Unique chemical structure
Its unique chemical structure and properties make it a valuable compound for various research and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 2159-36-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,5 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2159-36:
(6*2)+(5*1)+(4*5)+(3*9)+(2*3)+(1*6)=76
76 % 10 = 6
So 2159-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O4/c1-19-11-6-4-5-10(9-11)14(16)12-7-2-3-8-13(12)15(17)18/h2-9H,1H3,(H,17,18)
