2161-96-8 Usage
Uses
Used in Organic Chemistry:
2-Bromo-3-nitrothiphene is used as a synthetic intermediate for the preparation of more complex molecules. Its unique structure with bromine and nitro groups allows for various chemical reactions and transformations, making it a valuable compound in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-Bromo-3-nitrothiphene is used as a key building block in the synthesis of therapeutic agents. Its reactivity and functional groups enable the creation of diverse drug candidates with potential applications in treating various diseases and medical conditions.
Used in Agrochemical Production:
2-Bromo-3-nitrothiphene is also utilized in the agrochemical sector as a starting material for the development of new pesticides and herbicides. Its chemical properties make it suitable for the creation of compounds that can effectively control pests and weeds in agricultural settings.
Used in Specialty Chemicals:
In the production of specialty chemicals, 2-Bromo-3-nitrothiphene serves as a versatile precursor for the synthesis of compounds with specific applications in various industries. Its unique structure and reactivity contribute to the development of innovative products with tailored properties for use in areas such as materials science, coatings, and dyes.
Check Digit Verification of cas no
The CAS Registry Mumber 2161-96-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,6 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2161-96:
(6*2)+(5*1)+(4*6)+(3*1)+(2*9)+(1*6)=68
68 % 10 = 8
So 2161-96-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H2BrNO2S/c5-4-3(6(7)8)1-2-9-4/h1-2H
2161-96-8Relevant academic research and scientific papers
New methods for the synthesis of 4H-dithieno[3,2-b:2′,3′-d]pyrrole
F?rtsch, Sebastian,Vogt, Astrid,B?uerle, Peter
, (2017/08/23)
Various alternative methods for the synthesis of 4H-dithieno[3,2-b:2′,3′-d]pyrrole (DTP) starting from commercially available bromothiophene precursors are presented. Crucial steps involve the Cadogan reaction, Ullmann-type C─N couplings, or Buchwald-Hartwig–type aminations to build up the central pyrrole ring of DTP, respectively. The use of ammonia surrogates afforded the fused target heteroacene in overall yields of 33% to 63%, and the corresponding methods are applicable on large scale.