21615-36-1 Usage
Uses
Used in Chemical Synthesis:
2,2'-((3-Methylphenyl)imino)bisethyl diacetate is used as a reagent or intermediate in various chemical reactions, facilitating the synthesis of a range of organic compounds. Its unique structure and properties make it a valuable component in the production of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,2'-((3-Methylphenyl)imino)bisethyl diacetate is used as a key intermediate in the synthesis of certain drugs. Its ability to participate in various chemical reactions, such as condensation, addition, and substitution, allows for the creation of complex molecular structures with potential therapeutic applications.
Used in Agrochemical Industry:
2,2'-((3-Methylphenyl)imino)bisethyl diacetate is also utilized in the agrochemical sector as a precursor for the development of pesticides and other crop protection agents. Its involvement in the synthesis of these compounds contributes to the enhancement of agricultural productivity and crop protection against pests and diseases.
Used in Research and Development:
In the field of research and development, 2,2'-((3-Methylphenyl)imino)bisethyl diacetate serves as a valuable compound for exploring new chemical reactions and understanding the underlying mechanisms. Its unique properties and reactivity make it an essential tool for scientists and researchers working on the discovery and optimization of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 21615-36-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,6,1 and 5 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21615-36:
(7*2)+(6*1)+(5*6)+(4*1)+(3*5)+(2*3)+(1*6)=81
81 % 10 = 1
So 21615-36-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H21NO4/c1-12-5-4-6-15(11-12)16(7-9-19-13(2)17)8-10-20-14(3)18/h4-6,11H,7-10H2,1-3H3
