216955-75-8 Usage
General Description
6-(1H-IMIDAZOL-1-YL)NICOTINIC ACID is a chemical compound with a molecular formula C10H8N4O2. It is a derivative of nicotinic acid, also known as vitamin B3, and contains an imidazole ring. 6-(1H-IMIDAZOL-1-YL)NICOTINIC ACID has potential applications in pharmaceuticals and medicinal chemistry due to its ability to bind to specific receptors in the body, making it useful in the development of new drugs. It also has potential anti-inflammatory and antioxidant properties, making it a promising candidate for the treatment of various diseases and conditions. Additionally, 6-(1H-IMIDAZOL-1-YL)NICOTINIC ACID may have potential uses in research and development of new chemical compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 216955-75-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,9,5 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 216955-75:
(8*2)+(7*1)+(6*6)+(5*9)+(4*5)+(3*5)+(2*7)+(1*5)=158
158 % 10 = 8
So 216955-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O2/c13-9(14)7-1-2-8(11-5-7)12-4-3-10-6-12/h1-6H,(H,13,14)
216955-75-8Relevant articles and documents
DIHYDROPYRIDO PYRIMIDINE COMPOUNDS AS AUTOTAXIN INHIBITORS
-
Page/Page column 39; 40, (2014/10/29)
The present invention provides compounds of the formula (I) or a pharmaceutically acceptable salt thereof. Compounds of the invention are autotaxin inhibitors useful in the treatment of pain associated with osteoarthritis.
