21732-98-9 Usage
General Description
1H-[1,2,4]Triazole-3-carboxylic acid hydrazide is a chemical compound with the molecular formula C3H4N6O2. It is a hydrazide derivative of 1H-[1,2,4]Triazole-3-carboxylic acid, and is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. 1H-[1,2,4]Triazole-3-carboxylic acid hydrazide contains a triazole ring, which imparts unique properties and reactivity to the molecule. It is often used as a precursor for the synthesis of other heterocyclic compounds, and its hydrazide functionality allows for further functionalization to create diverse chemical structures. Additionally, 1H-[1,2,4]Triazole-3-carboxylic acid hydrazide may also be used in research and development applications, such as in the preparation of chemical libraries for drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 21732-98-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,7,3 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 21732-98:
(7*2)+(6*1)+(5*7)+(4*3)+(3*2)+(2*9)+(1*8)=99
99 % 10 = 9
So 21732-98-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N5O/c4-7-3(9)2-5-1-6-8-2/h1H,4H2,(H,7,9)(H,5,6,8)
21732-98-9Relevant articles and documents
CHEMICAL FOAMING AGENTS CONTAINING TOSYL GROUPS
-
Paragraph 0073, (2021/08/27)
Chemical foaming agents having p-toluenesulfonyl groups. Processes for preparing foamed polyolefin compositions using chemical foaming agents having p-toluenesulfonyl groups. Articles of manufacture containing formed polyolefins prepared using chemical foaming agents having p-toluenesulfonyl groups.
