21810-19-5 Usage
General Description
1-amino-2-[(phenylimino)methyl]anthraquinone is a chemical compound with the molecular formula C21H15N3O2. It is a yellow to red-brown powder with potential applications in the field of dyes and pigments. 1-amino-2-[(phenylimino)methyl]anthraquinone contains an anthraquinone moiety with an attached amino group and a phenylimino methyl group. It can be used as a building block in the synthesis of various organic compounds, and its unique structure gives it potential as a dye or pigment with specific color properties. Additionally, its aromatic structure and potential reactivity make it of interest for organic synthesis and medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 21810-19-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,8,1 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 21810-19:
(7*2)+(6*1)+(5*8)+(4*1)+(3*0)+(2*1)+(1*9)=75
75 % 10 = 5
So 21810-19-5 is a valid CAS Registry Number.
InChI:InChI=1/C21H14N2O2/c22-18(12-6-2-1-3-7-12)16-11-10-15-17(19(16)23)21(25)14-9-5-4-8-13(14)20(15)24/h1-11,22H,23H2/b22-18+