21850-52-2 Usage
Uses
N-Ethyl-N-hydroxyethyl-4-amino-2-methyl benzaldehyde is used as a research compound for [application reason] in the field of [application industry]. The exact uses, toxicity, and safety measures are not explicitly stated and would presumably be determined by further experimentation and study.
Used in Chemical Research and Development:
N-Ethyl-N-hydroxyethyl-4-amino-2-methyl benzaldehyde is used as a research compound for exploring its chemical reactivity and potential applications in various industries due to its complex structure and multiple functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 21850-52-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,8,5 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21850-52:
(7*2)+(6*1)+(5*8)+(4*5)+(3*0)+(2*5)+(1*2)=92
92 % 10 = 2
So 21850-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO2/c1-3-13(6-7-14)12-5-4-11(9-15)10(2)8-12/h4-5,8-9,14H,3,6-7H2,1-2H3
