21850-52-2 Usage
General Description
N-Ethyl-N-hydroxyethyl-4-amino-2-methyl benzaldehyde is a chemical compound likely used in research and development due to its complex structure. It has multiple functional groups like ethyl, hydroxyethyl, and amino groups, which indicates its potential for various types of chemical reactivity. It possesses an aromatic benzaldehyde core, which is further substituted by ethyl, hydroxyethyl, amino, and methyl groups. As for its physical attributes, they would depend on multiple factors such as the method of synthesis, the purity of compound, etc., and hence the general properties such as color, state of matter, smell, and toxicity could vary. Its exact uses, toxicity, and safety measures are not explicitly stated and would presumably be determined by further experimentation and study.
Check Digit Verification of cas no
The CAS Registry Mumber 21850-52-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,8,5 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21850-52:
(7*2)+(6*1)+(5*8)+(4*5)+(3*0)+(2*5)+(1*2)=92
92 % 10 = 2
So 21850-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO2/c1-3-13(6-7-14)12-5-4-11(9-15)10(2)8-12/h4-5,8-9,14H,3,6-7H2,1-2H3