219519-77-4 Usage
Uses
Used in Pharmaceutical Synthesis:
3-cyano-2-fluorobenzoic acid is utilized as an intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs. Its specific functional groups facilitate targeted chemical reactions, enhancing the compound's potential in medicinal chemistry.
Used in Agrochemical Production:
In the agrochemical industry, 3-cyano-2-fluorobenzoic acid serves as a key component in the creation of pesticides and other agricultural chemicals. Its incorporation can lead to the development of more effective and environmentally friendly products.
Used in Materials Science:
3-cyano-2-fluorobenzoic acid is employed as a precursor in the field of materials science, where it can be used to develop novel materials with specific properties. Its unique structure allows for the engineering of materials with tailored characteristics for various applications.
Used in Organic Chemistry Research:
As a building block in organic chemistry, 3-cyano-2-fluorobenzoic acid is used in the production of specialty chemicals and research reagents. It provides a foundation for exploring new chemical reactions and discovering innovative synthetic pathways.
Safety and Handling:
It is crucial to handle 3-cyano-2-fluorobenzoic acid with care, adhering to proper safety protocols and storage guidelines. This ensures the prevention of potential hazards and maintains the integrity of the compound for its intended applications.
Check Digit Verification of cas no
The CAS Registry Mumber 219519-77-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,5,1 and 9 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 219519-77:
(8*2)+(7*1)+(6*9)+(5*5)+(4*1)+(3*9)+(2*7)+(1*7)=154
154 % 10 = 4
So 219519-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H4FNO2/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-3H,(H,11,12)
