219793-85-8 Usage
General Description
DIETHYL 2-([(2-CHLORO-3-PYRIDYL)CARBONYL]AMINO)MALONATE is a chemical compound that is used in the field of organic chemistry. It is an ester derivative of malonic acid and is commonly used as a reagent in the synthesis of various pharmaceuticals and agrochemicals. The compound contains a chloropyridine moiety and a carbonyl group, making it suitable for a wide range of chemical reactions. It is known for its role in the production of pyridine heterocycles and other bioactive compounds, and has potential applications in drug discovery and development. Additionally, it may have insecticidal and herbicidal properties, making it useful in the formulation of pesticides. Overall, DIETHYL 2-([(2-CHLORO-3-PYRIDYL)CARBONYL]AMINO)MALONATE is a versatile chemical that is valuable in both research and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 219793-85-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,7,9 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 219793-85:
(8*2)+(7*1)+(6*9)+(5*7)+(4*9)+(3*3)+(2*8)+(1*5)=178
178 % 10 = 8
So 219793-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H15ClN2O5/c1-3-20-12(18)9(13(19)21-4-2)16-11(17)8-6-5-7-15-10(8)14/h5-7,9H,3-4H2,1-2H3,(H,16,17)
