219803-57-3 Usage
General Description
(S)-2-Amino-but-3-en-1-ol hydrochloride is a chemical compound characterized by its chloride salt form. As its name suggests, it has an amino group (–NH2) and a hydroxyl group (–OH) attached to a butene backbone (a four-carbon chain), making it a form of amino alcohol. The "(S)-" prefix in its name indicates the specific stereochemistry of the compound, meaning it has a particular three-dimensional spatial configuration. (S)-2-AMINO-BUT-3-EN-1-OL HYDROCHLORIDE is often used in synthesis and chemical reactions in the laboratory. Its specific properties such as reactivity, toxicity, or uses can greatly vary depending on the field of application and should be handled with appropriate safety measures.
Check Digit Verification of cas no
The CAS Registry Mumber 219803-57-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,8,0 and 3 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 219803-57:
(8*2)+(7*1)+(6*9)+(5*8)+(4*0)+(3*3)+(2*5)+(1*7)=143
143 % 10 = 3
So 219803-57-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H9NO.ClH/c1-2-4(5)3-6;/h2,4,6H,1,3,5H2;1H/t4-;/m0./s1
