219858-64-7 Usage
General Description
2-Acetylamino-3-(3-fluoro-4-hydroxy-phenyl)-propionic acid is a chemical compound with the molecular formula C12H13NO4F. It is a derivative of the non-steroidal anti-inflammatory drug (NSAID) flurbiprofen, and it is often used in the treatment of pain, inflammation, and fever. The compound acts as an inhibitor of the enzyme cyclooxygenase, which plays a key role in the synthesis of prostaglandins, thereby reducing the production of inflammatory mediators. Additionally, the presence of the acetylamino group in the molecule allows for enhanced analgesic and anti-inflammatory activity. Overall, 2-acetylamino-3-(3-fluoro-4-hydroxy-phenyl)-propionic acid is a valuable pharmaceutical compound with potential therapeutic applications in the management of various inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 219858-64-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,8,5 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 219858-64:
(8*2)+(7*1)+(6*9)+(5*8)+(4*5)+(3*8)+(2*6)+(1*4)=177
177 % 10 = 7
So 219858-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H12FNO4/c1-6(14)13-9(11(16)17)5-7-2-3-10(15)8(12)4-7/h2-4,9,15H,5H2,1H3,(H,13,14)(H,16,17)
