219865-85-7 Usage
General Description
6-[(2,5-Dichlorophenyl)thio]pyridin-3-amine is a chemical compound with the molecular formula C11H7Cl2N3S. It is a pyridine derivative with a thiol group attached to the phenyl ring, and it is commonly used as a building block in medicinal chemistry and drug discovery. The compound has the potential to act as a potent inhibitor for various enzymes and receptors in the human body, making it a promising candidate for the development of new pharmaceuticals. Additionally, its unique structure and reactivity make it valuable for the synthesis of complex organic molecules in the laboratory. However, caution should be taken when handling this chemical, as it may pose health and environmental hazards if not properly managed.
Check Digit Verification of cas no
The CAS Registry Mumber 219865-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,9,8,6 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 219865-85:
(8*2)+(7*1)+(6*9)+(5*8)+(4*6)+(3*5)+(2*8)+(1*5)=177
177 % 10 = 7
So 219865-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H8Cl2N2S/c12-7-1-3-9(13)10(5-7)16-11-4-2-8(14)6-15-11/h1-6H,14H2
Xi:Irritant;
